C24H25FN6O3 — CID 155157867
N-[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 155157867) has the molecular formula C24H25FN6O3 and a molecular weight of 464.50 g/mol. Its IUPAC name is N-[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | N-[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 155157867 |
| Molecular Formula | C24H25FN6O3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | COCCC(=O)N1CCc2cc(F)c(C(=O)Nc3cccc(-c4nnc5n4CCC5)n3)cc2C1 |
| InChI | InChI=1S/C24H25FN6O3/c1-34-11-8-22(32)30-10-7-15-13-18(25)17(12-16(15)14-30)24(33)27-20-5-2-4-19(26-20)23-29-28-21-6-3-9-31(21)23/h2,4-5,12-13H,3,6-11,14H2,1H3,(H,26,27,33) |
| InChIKey | OIOVCTBHBQNFEU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |