C26H28N6O5 — CID 155157686
oxolan-3-yl 7-[[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 155157686) has the molecular formula C26H28N6O5 and a molecular weight of 504.55 g/mol. Its IUPAC name is oxolan-3-yl 7-[[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | oxolan-3-yl 7-[[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 155157686 |
| Molecular Formula | C26H28N6O5 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | oxolan-3-yl 7-[[6-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-pyridinyl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COc1cc2c(cc1C(=O)Nc1cccc(-c3nnc4n3CCC4)n1)CN(C(=O)OC1CCOC1)CC2 |
| InChI | InChI=1S/C26H28N6O5/c1-35-21-13-16-7-10-31(26(34)37-18-8-11-36-15-18)14-17(16)12-19(21)25(33)28-22-5-2-4-20(27-22)24-30-29-23-6-3-9-32(23)24/h2,4-5,12-13,18H,3,6-11,14-15H2,1H3,(H,27,28,33) |
| InChIKey | GFACKQUTQRHCQY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |