C20H21FN6OS — CID 142483454
N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-2-cyclopropyl-5-fluoro-1,3-benzothiazole-6-carboxamide (PubChem CID 142483454) has the molecular formula C20H21FN6OS and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-2-cyclopropyl-5-fluoro-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-2-cyclopropyl-5-fluoro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 142483454 |
| Molecular Formula | C20H21FN6OS |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-2-cyclopropyl-5-fluoro-1,3-benzothiazole-6-carboxamide |
| SMILES | [H]/N=C(/c1cccc(NC(=O)c2cc3sc(C4CC4)nc3cc2F)n1)N(N)C(C)C |
| InChI | InChI=1S/C20H21FN6OS/c1-10(2)27(23)18(22)14-4-3-5-17(24-14)26-19(28)12-8-16-15(9-13(12)21)25-20(29-16)11-6-7-11/h3-5,8-11,22H,6-7,23H2,1-2H3,(H,24,26,28)/b22-18- |
| InChIKey | NCCZJSCVKOLVLZ-PYCFMQQDSA-N |
| XLogP | 3.87 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|