C22H25N7O2 — CID 153359403
N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-4-(3-cyclopropyl-1,2-oxazol-5-yl)-5-methylpyridine-2-carboxamide (PubChem CID 153359403) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-4-(3-cyclopropyl-1,2-oxazol-5-yl)-5-methylpyridine-2-carboxamide.
| Compound Name | N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-4-(3-cyclopropyl-1,2-oxazol-5-yl)-5-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 153359403 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[6-(N-amino-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-4-(3-cyclopropyl-1,2-oxazol-5-yl)-5-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(/c1cccc(NC(=O)c2cc(-c3cc(C4CC4)no3)c(C)cn2)n1)N(N)C(C)C |
| InChI | InChI=1S/C22H25N7O2/c1-12(2)29(24)21(23)16-5-4-6-20(26-16)27-22(30)18-9-15(13(3)11-25-18)19-10-17(28-31-19)14-7-8-14/h4-6,9-12,14,23H,7-8,24H2,1-3H3,(H,26,27,30)/b23-21- |
| InChIKey | XNWZQYXJWLZMKA-LNVKXUELSA-N |
| XLogP | 3.48 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|