C23H32N8O2S — CID 142483732
N-[6-(N-hydrazinyl-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-6-methoxy-2-pyrrolidin-1-ylsulfanyl-1,3-dihydroisoindole-5-carboxamide (PubChem CID 142483732) has the molecular formula C23H32N8O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is N-[6-(N-hydrazinyl-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-6-methoxy-2-pyrrolidin-1-ylsulfanyl-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-[6-(N-hydrazinyl-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-6-methoxy-2-pyrrolidin-1-ylsulfanyl-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 142483732 |
| Molecular Formula | C23H32N8O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[6-(N-hydrazinyl-N-propan-2-ylcarbamimidoyl)-2-pyridinyl]-6-methoxy-2-pyrrolidin-1-ylsulfanyl-1,3-dihydroisoindole-5-carboxamide |
| SMILES | [H]/N=C(/c1cccc(NC(=O)c2cc3c(cc2OC)CN(SN2CCCC2)C3)n1)N(NN)C(C)C |
| InChI | InChI=1S/C23H32N8O2S/c1-15(2)31(28-25)22(24)19-7-6-8-21(26-19)27-23(32)18-11-16-13-30(34-29-9-4-5-10-29)14-17(16)12-20(18)33-3/h6-8,11-12,15,24,28H,4-5,9-10,13-14,25H2,1-3H3,(H,26,27,32)/b24-22- |
| InChIKey | SLNJWYCYTDIOGI-GYHWCHFESA-N |
| XLogP | 2.73 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|