C37H32O8 — CID 149082567
[4-[(1E,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenyl] (2R)-2-(3-benzoylphenyl)propanoate (PubChem CID 149082567) has the molecular formula C37H32O8 and a molecular weight of 604.66 g/mol. Its IUPAC name is [4-[(1E,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenyl] (2R)-2-(3-benzoylphenyl)propanoate.
| Compound Name | [4-[(1E,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenyl] (2R)-2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 149082567 |
| Molecular Formula | C37H32O8 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | [4-[(1E,6E)-3-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-5-oxohepta-1,3,6-trienyl]-2-methoxyphenyl] (2R)-2-(3-benzoylphenyl)propanoate |
| SMILES | COc1cc(/C=C/C(=O)C=C(O)/C=C/c2ccc(OC(=O)[C@H](C)c3cccc(C(=O)c4ccccc4)c3)c(OC)c2)ccc1O |
| InChI | InChI=1S/C37H32O8/c1-24(28-10-7-11-29(22-28)36(41)27-8-5-4-6-9-27)37(42)45-33-19-15-26(21-35(33)44-3)13-17-31(39)23-30(38)16-12-25-14-18-32(40)34(20-25)43-2/h4-24,39-40H,1-3H3/b16-12+,17-13+,31-23?/t24-/m1/s1 |
| InChIKey | KOXZTXVDAKUQBV-QITNKWAGSA-N |
| XLogP | 7.09 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|