C30H31N7O4S — CID 149096564
4-[(1R,2R)-2-[(Z)-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]-ethylidene-λ4-sulfanyl]-1-methoxypropyl]benzene-1,3-dicarbonitrile (PubChem CID 149096564) has the molecular formula C30H31N7O4S and a molecular weight of 585.69 g/mol. Its IUPAC name is 4-[(1R,2R)-2-[(Z)-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]-ethylidene-λ4-sulfanyl]-1-methoxypropyl]benzene-1,3-dicarbonitrile.
| Compound Name | 4-[(1R,2R)-2-[(Z)-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]-ethylidene-λ4-sulfanyl]-1-methoxypropyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 149096564 |
| Molecular Formula | C30H31N7O4S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 4-[(1R,2R)-2-[(Z)-[[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]amino]-ethylidene-λ4-sulfanyl]-1-methoxypropyl]benzene-1,3-dicarbonitrile |
| SMILES | C/C=S(\Nc1nnc(-c2cccc(OC)n2)n1-c1c(OC)cccc1OC)[C@H](C)[C@H](OC)c1ccc(C#N)cc1C#N |
| InChI | InChI=1S/C30H31N7O4S/c1-7-42(19(2)28(41-6)22-15-14-20(17-31)16-21(22)18-32)36-30-35-34-29(23-10-8-13-26(33-23)40-5)37(30)27-24(38-3)11-9-12-25(27)39-4/h7-16,19,28H,1-6H3,(H,35,36)/t19-,28+,42?/m1/s1 |
| InChIKey | QTSKWXWEIHJGFR-BSJFQCNCSA-N |
| XLogP | 5.29 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|