C25H29N3O2 — CID 149097432
6-[1-[4-methyl-3-(4-methyl-2-oxopentyl)benzoyl]piperidin-4-yl]pyridine-3-carbonitrile (PubChem CID 149097432) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 6-[1-[4-methyl-3-(4-methyl-2-oxopentyl)benzoyl]piperidin-4-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[1-[4-methyl-3-(4-methyl-2-oxopentyl)benzoyl]piperidin-4-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 149097432 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 6-[1-[4-methyl-3-(4-methyl-2-oxopentyl)benzoyl]piperidin-4-yl]pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C(=O)N2CCC(c3ccc(C#N)cn3)CC2)cc1CC(=O)CC(C)C |
| InChI | InChI=1S/C25H29N3O2/c1-17(2)12-23(29)14-22-13-21(6-4-18(22)3)25(30)28-10-8-20(9-11-28)24-7-5-19(15-26)16-27-24/h4-7,13,16-17,20H,8-12,14H2,1-3H3 |
| InChIKey | QTWQYNHWRUNIBA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |