C20H22N2O5S — CID 1490998
methyl 2-(4-benzamidopiperidin-1-yl)sulfonylbenzoate (PubChem CID 1490998) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is methyl 2-(4-benzamidopiperidin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 2-(4-benzamidopiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 1490998 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methyl 2-(4-benzamidopiperidin-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N1CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2O5S/c1-27-20(24)17-9-5-6-10-18(17)28(25,26)22-13-11-16(12-14-22)21-19(23)15-7-3-2-4-8-15/h2-10,16H,11-14H2,1H3,(H,21,23) |
| InChIKey | FKSJBFMUNWPNHI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |