C11H16O2 — CID 14910840
2-(3,4-dihydro-2H-pyran-5-yl)cyclohexan-1-one (PubChem CID 14910840) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-5-yl)cyclohexan-1-one.
| Compound Name | 2-(3,4-dihydro-2H-pyran-5-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 14910840 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-5-yl)cyclohexan-1-one |
| SMILES | O=C1CCCCC1C1=COCCC1 |
| InChI | InChI=1S/C11H16O2/c12-11-6-2-1-5-10(11)9-4-3-7-13-8-9/h8,10H,1-7H2 |
| InChIKey | LVWGLIMKFLODAP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |