C26H34N4O2 — CID 149112027
2-[(1-acetylpiperidin-4-yl)methyl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]pyridine-4-carboxamide (PubChem CID 149112027) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[(1-acetylpiperidin-4-yl)methyl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]pyridine-4-carboxamide.
| Compound Name | 2-[(1-acetylpiperidin-4-yl)methyl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 149112027 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-[(1-acetylpiperidin-4-yl)methyl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]pyridine-4-carboxamide |
| SMILES | CC(=O)N1CCC(Cc2cc(C(=O)NCCCN3CCc4ccccc4C3)ccn2)CC1 |
| InChI | InChI=1S/C26H34N4O2/c1-20(31)30-15-8-21(9-16-30)17-25-18-23(7-12-27-25)26(32)28-11-4-13-29-14-10-22-5-2-3-6-24(22)19-29/h2-3,5-7,12,18,21H,4,8-11,13-17,19H2,1H3,(H,28,32) |
| InChIKey | QXLGMFPDFXJJHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|