C26H33N7O — CID 166898141
1-[4-[[4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]pyrido[3,4-d]pyrimidin-8-yl]amino]piperidin-1-yl]ethanone (PubChem CID 166898141) has the molecular formula C26H33N7O and a molecular weight of 459.60 g/mol. Its IUPAC name is 1-[4-[[4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]pyrido[3,4-d]pyrimidin-8-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]pyrido[3,4-d]pyrimidin-8-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 166898141 |
| Molecular Formula | C26H33N7O |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 1-[4-[[4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylamino]pyrido[3,4-d]pyrimidin-8-yl]amino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Nc2nccc3c(NCCCN4CCc5ccccc5C4)ncnc23)CC1 |
| InChI | InChI=1S/C26H33N7O/c1-19(34)33-15-9-22(10-16-33)31-26-24-23(7-12-28-26)25(30-18-29-24)27-11-4-13-32-14-8-20-5-2-3-6-21(20)17-32/h2-3,5-7,12,18,22H,4,8-11,13-17H2,1H3,(H,28,31)(H,27,29,30) |
| InChIKey | KHTAXOAYVSVOHX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|