C39H41N3O2 — CID 149123304
2-carbazol-9-yl-6-[2-[2-(dimethylamino)ethyl-[(2-hydroxy-5-methyl-3-phenylphenyl)methyl]amino]ethyl]-4-methylphenol (PubChem CID 149123304) has the molecular formula C39H41N3O2 and a molecular weight of 583.78 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-[2-[2-(dimethylamino)ethyl-[(2-hydroxy-5-methyl-3-phenylphenyl)methyl]amino]ethyl]-4-methylphenol.
| Compound Name | 2-carbazol-9-yl-6-[2-[2-(dimethylamino)ethyl-[(2-hydroxy-5-methyl-3-phenylphenyl)methyl]amino]ethyl]-4-methylphenol |
|---|---|
| PubChem CID | 149123304 |
| Molecular Formula | C39H41N3O2 |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | 2-carbazol-9-yl-6-[2-[2-(dimethylamino)ethyl-[(2-hydroxy-5-methyl-3-phenylphenyl)methyl]amino]ethyl]-4-methylphenol |
| SMILES | Cc1cc(CN(CCc2cc(C)cc(-n3c4ccccc4c4ccccc43)c2O)CCN(C)C)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C39H41N3O2/c1-27-23-31(38(43)34(24-27)29-12-6-5-7-13-29)26-41(21-20-40(3)4)19-18-30-22-28(2)25-37(39(30)44)42-35-16-10-8-14-32(35)33-15-9-11-17-36(33)42/h5-17,22-25,43-44H,18-21,26H2,1-4H3 |
| InChIKey | RACUCFCTPWUIHT-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|