C51H47N3O3 — CID 134225902
2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-(dimethylamino)butoxy]-5-methylphenyl]-4-methylphenol (PubChem CID 134225902) has the molecular formula C51H47N3O3 and a molecular weight of 749.95 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-(dimethylamino)butoxy]-5-methylphenyl]-4-methylphenol.
| Compound Name | 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-(dimethylamino)butoxy]-5-methylphenyl]-4-methylphenol |
|---|---|
| PubChem CID | 134225902 |
| Molecular Formula | C51H47N3O3 |
| Molecular Weight | 749.95 g/mol |
| Exact Mass | 749.36 |
| IUPAC Name | 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-(dimethylamino)butoxy]-5-methylphenyl]-4-methylphenol |
| SMILES | Cc1cc(-c2cc(C)cc(-n3c4ccccc4c4ccccc43)c2O)c(OCCCCN(C)C)c(-c2cc(C)cc(-n3c4ccccc4c4ccccc43)c2O)c1 |
| InChI | InChI=1S/C51H47N3O3/c1-32-28-41(39-26-33(2)30-47(49(39)55)53-43-20-10-6-16-35(43)36-17-7-11-21-44(36)53)51(57-25-15-14-24-52(4)5)42(29-32)40-27-34(3)31-48(50(40)56)54-45-22-12-8-18-37(45)38-19-9-13-23-46(38)54/h6-13,16-23,26-31,55-56H,14-15,24-25H2,1-5H3 |
| InChIKey | KKQOZXRUTYXHIA-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 62.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.95 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|