C48H40N2O2S2 — CID 134226012
2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-5-methyl-2-(2-methylsulfanylethylsulfanyl)phenyl]-4-methylphenol (PubChem CID 134226012) has the molecular formula C48H40N2O2S2 and a molecular weight of 740.99 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-5-methyl-2-(2-methylsulfanylethylsulfanyl)phenyl]-4-methylphenol.
| Compound Name | 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-5-methyl-2-(2-methylsulfanylethylsulfanyl)phenyl]-4-methylphenol |
|---|---|
| PubChem CID | 134226012 |
| Molecular Formula | C48H40N2O2S2 |
| Molecular Weight | 740.99 g/mol |
| Exact Mass | 740.25 |
| IUPAC Name | 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-5-methyl-2-(2-methylsulfanylethylsulfanyl)phenyl]-4-methylphenol |
| SMILES | CSCCSc1c(-c2cc(C)cc(-n3c4ccccc4c4ccccc43)c2O)cc(C)cc1-c1cc(C)cc(-n2c3ccccc3c3ccccc32)c1O |
| InChI | InChI=1S/C48H40N2O2S2/c1-29-25-38(36-23-30(2)27-44(46(36)51)49-40-17-9-5-13-32(40)33-14-6-10-18-41(33)49)48(54-22-21-53-4)39(26-29)37-24-31(3)28-45(47(37)52)50-42-19-11-7-15-34(42)35-16-8-12-20-43(35)50/h5-20,23-28,51-52H,21-22H2,1-4H3 |
| InChIKey | CAPVQXXWWFOSIM-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.99 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|