C52H50N2O2P2 — CID 134225963
2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-dimethylphosphanylbutyl(methyl)phosphanyl]-5-methylphenyl]-4-methylphenol (PubChem CID 134225963) has the molecular formula C52H50N2O2P2 and a molecular weight of 796.93 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-dimethylphosphanylbutyl(methyl)phosphanyl]-5-methylphenyl]-4-methylphenol.
| Compound Name | 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-dimethylphosphanylbutyl(methyl)phosphanyl]-5-methylphenyl]-4-methylphenol |
|---|---|
| PubChem CID | 134225963 |
| Molecular Formula | C52H50N2O2P2 |
| Molecular Weight | 796.93 g/mol |
| Exact Mass | 796.33 |
| IUPAC Name | 2-carbazol-9-yl-6-[3-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)-2-[4-dimethylphosphanylbutyl(methyl)phosphanyl]-5-methylphenyl]-4-methylphenol |
| SMILES | Cc1cc(-c2cc(C)cc(-n3c4ccccc4c4ccccc43)c2O)c(P(C)CCCCP(C)C)c(-c2cc(C)cc(-n3c4ccccc4c4ccccc43)c2O)c1 |
| InChI | InChI=1S/C52H50N2O2P2/c1-33-29-42(40-27-34(2)31-48(50(40)55)53-44-21-11-7-17-36(44)37-18-8-12-22-45(37)53)52(58(6)26-16-15-25-57(4)5)43(30-33)41-28-35(3)32-49(51(41)56)54-46-23-13-9-19-38(46)39-20-10-14-24-47(39)54/h7-14,17-24,27-32,55-56H,15-16,25-26H2,1-6H3 |
| InChIKey | YSWIFCMKEXLNQC-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.93 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|