C16H24O4S — CID 14913004
3-(benzenesulfonyl)-4-(2,3-dimethylbutan-2-yloxy)butan-2-one (PubChem CID 14913004) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-(2,3-dimethylbutan-2-yloxy)butan-2-one.
| Compound Name | 3-(benzenesulfonyl)-4-(2,3-dimethylbutan-2-yloxy)butan-2-one |
|---|---|
| PubChem CID | 14913004 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-(benzenesulfonyl)-4-(2,3-dimethylbutan-2-yloxy)butan-2-one |
| SMILES | CC(=O)C(COC(C)(C)C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24O4S/c1-12(2)16(4,5)20-11-15(13(3)17)21(18,19)14-9-7-6-8-10-14/h6-10,12,15H,11H2,1-5H3 |
| InChIKey | IWUFDTKTUXWREG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |