C13H14O4S — CID 10858410
5-(benzenesulfonyl)-2,2-dimethyl-3H-pyran-4-one (PubChem CID 10858410) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2,2-dimethyl-3H-pyran-4-one.
| Compound Name | 5-(benzenesulfonyl)-2,2-dimethyl-3H-pyran-4-one |
|---|---|
| PubChem CID | 10858410 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 5-(benzenesulfonyl)-2,2-dimethyl-3H-pyran-4-one |
| SMILES | CC1(C)CC(=O)C(S(=O)(=O)c2ccccc2)=CO1 |
| InChI | InChI=1S/C13H14O4S/c1-13(2)8-11(14)12(9-17-13)18(15,16)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | YSWNBWNFDIYCQT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |