C14H20O4S — CID 24976679
2-(benzenesulfonyl)-1-methoxy-4,4-dimethylpentan-3-one (PubChem CID 24976679) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-methoxy-4,4-dimethylpentan-3-one.
| Compound Name | 2-(benzenesulfonyl)-1-methoxy-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 24976679 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(benzenesulfonyl)-1-methoxy-4,4-dimethylpentan-3-one |
| SMILES | COCC(C(=O)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20O4S/c1-14(2,3)13(15)12(10-18-4)19(16,17)11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3 |
| InChIKey | ASHXSEZIELIYEX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |