C13H16O5S — CID 14913015
3-(benzenesulfonyl)-4-(1,3-dioxolan-2-yl)butan-2-one (PubChem CID 14913015) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-(1,3-dioxolan-2-yl)butan-2-one.
| Compound Name | 3-(benzenesulfonyl)-4-(1,3-dioxolan-2-yl)butan-2-one |
|---|---|
| PubChem CID | 14913015 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-(benzenesulfonyl)-4-(1,3-dioxolan-2-yl)butan-2-one |
| SMILES | CC(=O)C(CC1OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O5S/c1-10(14)12(9-13-17-7-8-18-13)19(15,16)11-5-3-2-4-6-11/h2-6,12-13H,7-9H2,1H3 |
| InChIKey | DZKNEXYNTIUAKZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |