C19H17N5O4S — CID 14913746
3-nitro-N-[[3-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamoyl]benzamide (PubChem CID 14913746) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is 3-nitro-N-[[3-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamoyl]benzamide.
| Compound Name | 3-nitro-N-[[3-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 14913746 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 3-nitro-N-[[3-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1cccc([N+](=O)[O-])c1)Nc1cccc([C@H]2CN3CCSC3=N2)c1 |
| InChI | InChI=1S/C19H17N5O4S/c25-17(13-4-2-6-15(10-13)24(27)28)22-18(26)20-14-5-1-3-12(9-14)16-11-23-7-8-29-19(23)21-16/h1-6,9-10,16H,7-8,11H2,(H2,20,22,25,26)/t16-/m1/s1 |
| InChIKey | KGHKBCOLWWSKGF-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|