C25H21N3O4S — CID 42806172
N-[3-[3-(2,3-dihydro-1H-inden-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide (PubChem CID 42806172) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is N-[3-[3-(2,3-dihydro-1H-inden-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[3-(2,3-dihydro-1H-inden-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42806172 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | N-[3-[3-(2,3-dihydro-1H-inden-5-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1cccc(C2SCC(=O)N2c2ccc3c(c2)CCC3)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21N3O4S/c29-23-15-33-25(27(23)21-11-10-16-4-1-5-17(16)13-21)19-7-2-8-20(12-19)26-24(30)18-6-3-9-22(14-18)28(31)32/h2-3,6-14,25H,1,4-5,15H2,(H,26,30) |
| InChIKey | KOYHLGOHBRJDJA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|