C24H21N3O5S — CID 93126296
N-[3-[(2R)-3-(2-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide (PubChem CID 93126296) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is N-[3-[(2R)-3-(2-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[(2R)-3-(2-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 93126296 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-[3-[(2R)-3-(2-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]-3-nitrobenzamide |
| SMILES | CCOc1ccccc1N1C(=O)CS[C@@H]1c1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H21N3O5S/c1-2-32-21-12-4-3-11-20(21)26-22(28)15-33-24(26)17-8-5-9-18(13-17)25-23(29)16-7-6-10-19(14-16)27(30)31/h3-14,24H,2,15H2,1H3,(H,25,29)/t24-/m1/s1 |
| InChIKey | NUNUDAWFKWOJJY-XMMPIXPASA-N |
| XLogP | 5.02 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|