C31H27NO4S — CID 149139518
1-(4-morpholin-4-ylphenyl)-2-[4-[4-(2-oxo-2-thiophen-3-ylethyl)benzoyl]phenyl]ethanone (PubChem CID 149139518) has the molecular formula C31H27NO4S and a molecular weight of 509.63 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylphenyl)-2-[4-[4-(2-oxo-2-thiophen-3-ylethyl)benzoyl]phenyl]ethanone.
| Compound Name | 1-(4-morpholin-4-ylphenyl)-2-[4-[4-(2-oxo-2-thiophen-3-ylethyl)benzoyl]phenyl]ethanone |
|---|---|
| PubChem CID | 149139518 |
| Molecular Formula | C31H27NO4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 1-(4-morpholin-4-ylphenyl)-2-[4-[4-(2-oxo-2-thiophen-3-ylethyl)benzoyl]phenyl]ethanone |
| SMILES | O=C(Cc1ccc(C(=O)c2ccc(CC(=O)c3ccsc3)cc2)cc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H27NO4S/c33-29(24-9-11-28(12-10-24)32-14-16-36-17-15-32)19-22-1-5-25(6-2-22)31(35)26-7-3-23(4-8-26)20-30(34)27-13-18-37-21-27/h1-13,18,21H,14-17,19-20H2 |
| InChIKey | RHJNIDNDVBGTNM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |