C20H20N4O3S2 — CID 45497639
N-[4-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]thiophene-3-carboxamide (PubChem CID 45497639) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[4-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[4-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 45497639 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[4-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]thiophene-3-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccsc2)n1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H20N4O3S2/c25-18(21-15-1-3-17(4-2-15)24-6-8-27-9-7-24)11-16-13-29-20(22-16)23-19(26)14-5-10-28-12-14/h1-5,10,12-13H,6-9,11H2,(H,21,25)(H,22,23,26) |
| InChIKey | RPWNLMUOFVRPOY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|