C10H5F15 — CID 149142843
1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pent-2-ene (PubChem CID 149142843) has the molecular formula C10H5F15 and a molecular weight of 410.12 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 149142843 |
| Molecular Formula | C10H5F15 |
| Molecular Weight | 410.12 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pent-2-ene |
| SMILES | CC(=C(C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15/c1-2(6(11,12)13)3(4(7(14,15)16)8(17,18)19)5(9(20,21)22)10(23,24)25/h4-5H,1H3 |
| InChIKey | RILWBLFOCFUQQI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.12 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|