C12H9F15 — CID 23440024
1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene (PubChem CID 23440024) has the molecular formula C12H9F15 and a molecular weight of 438.17 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 23440024 |
| Molecular Formula | C12H9F15 |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene |
| SMILES | CC(=C(C(C)(C(F)(F)F)C(F)(F)F)C(C)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H9F15/c1-4(8(13,14)15)5(6(2,9(16,17)18)10(19,20)21)7(3,11(22,23)24)12(25,26)27/h1-3H3 |
| InChIKey | WGVHNOOEKIVHJN-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|