C10H6F12O — CID 10547106
(3E)-1,1,1,5,5,6,6,6-octafluoro-3-(1-fluoroethylidene)-4-methyl-4-(trifluoromethyl)hexan-2-one (PubChem CID 10547106) has the molecular formula C10H6F12O and a molecular weight of 370.13 g/mol. Its IUPAC name is (3E)-1,1,1,5,5,6,6,6-octafluoro-3-(1-fluoroethylidene)-4-methyl-4-(trifluoromethyl)hexan-2-one.
| Compound Name | (3E)-1,1,1,5,5,6,6,6-octafluoro-3-(1-fluoroethylidene)-4-methyl-4-(trifluoromethyl)hexan-2-one |
|---|---|
| PubChem CID | 10547106 |
| Molecular Formula | C10H6F12O |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (3E)-1,1,1,5,5,6,6,6-octafluoro-3-(1-fluoroethylidene)-4-methyl-4-(trifluoromethyl)hexan-2-one |
| SMILES | C/C(F)=C(\C(=O)C(F)(F)F)C(C)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F12O/c1-3(11)4(5(23)7(12,13)14)6(2,9(17,18)19)8(15,16)10(20,21)22/h1-2H3/b4-3- |
| InChIKey | UGPFXYCCRWKFPK-ARJAWSKDSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|