About sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid
sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid (PubChem CID 173413742) has the molecular formula C5H5F6NaO2
and a molecular weight of 234.07 g/mol. Its IUPAC name is sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid.
Molecular Properties
| Compound Name | sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid |
| PubChem CID | 173413742 |
| Molecular Formula | C5H5F6NaO2 |
| Molecular Weight | 234.07 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid |
| SMILES | CC(C(=O)O)(C(F)(F)F)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C5H4F6O2.Na.H/c1-3(2(12)13,4(6,7)8)5(9,10)11;;/h1H3,(H,12,13);;/q;+1;-1 |
| InChIKey | RQLFZKLRHTUGAO-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.07 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid?
The IUPAC name of sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid (CID 173413742) is sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid.
What is the SMILES notation for sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid?
The canonical SMILES for sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid is CC(C(=O)O)(C(F)(F)F)C(F)(F)F.[H-].[Na+].
What is the InChIKey of sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid?
The InChIKey is RQLFZKLRHTUGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F6O2.Na.H/c1-3(2(12)13,4(6,7)8)5(9,10)11;;/h1H3,(H,12,13);;/q;+1;-1.
What are the key properties of sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid?
sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid has a molecular weight of 234.07 g/mol, XLogP of -0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoic acid is sourced from PubChem (CID 173413742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).