C5H7NaO6 — CID 174341245
sodium;ethane-1,1,1-tricarboxylic acid;hydride (PubChem CID 174341245) has the molecular formula C5H7NaO6 and a molecular weight of 186.09 g/mol. Its IUPAC name is sodium;ethane-1,1,1-tricarboxylic acid;hydride.
| Compound Name | sodium;ethane-1,1,1-tricarboxylic acid;hydride |
|---|---|
| PubChem CID | 174341245 |
| Molecular Formula | C5H7NaO6 |
| Molecular Weight | 186.09 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | sodium;ethane-1,1,1-tricarboxylic acid;hydride |
| SMILES | CC(C(=O)O)(C(=O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C5H6O6.Na.H/c1-5(2(6)7,3(8)9)4(10)11;;/h1H3,(H,6,7)(H,8,9)(H,10,11);;/q;+1;-1 |
| InChIKey | BKAHMFLIZOGJEF-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.09 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|