C20H19ClN6 — CID 149144132
1-[2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-1-ethylbenzimidazol-5-yl]-N-methylmethanimine (PubChem CID 149144132) has the molecular formula C20H19ClN6 and a molecular weight of 378.87 g/mol. Its IUPAC name is 1-[2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-1-ethylbenzimidazol-5-yl]-N-methylmethanimine.
| Compound Name | 1-[2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-1-ethylbenzimidazol-5-yl]-N-methylmethanimine |
|---|---|
| PubChem CID | 149144132 |
| Molecular Formula | C20H19ClN6 |
| Molecular Weight | 378.87 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[2-[[2-(6-chloro-2-pyridinyl)imidazol-1-yl]methyl]-1-ethylbenzimidazol-5-yl]-N-methylmethanimine |
| SMILES | CCn1c(Cn2ccnc2-c2cccc(Cl)n2)nc2cc(/C=N/C)ccc21 |
| InChI | InChI=1S/C20H19ClN6/c1-3-27-17-8-7-14(12-22-2)11-16(17)25-19(27)13-26-10-9-23-20(26)15-5-4-6-18(21)24-15/h4-12H,3,13H2,1-2H3/b22-12+ |
| InChIKey | RJNBGNGFXKCXBK-WSDLNYQXSA-N |
| XLogP | 4.07 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|