C19H16N6 — CID 22380091
1-ethyl-2-[(2-pyridin-2-ylimidazol-1-yl)methyl]benzimidazole-5-carbonitrile (PubChem CID 22380091) has the molecular formula C19H16N6 and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-ethyl-2-[(2-pyridin-2-ylimidazol-1-yl)methyl]benzimidazole-5-carbonitrile.
| Compound Name | 1-ethyl-2-[(2-pyridin-2-ylimidazol-1-yl)methyl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 22380091 |
| Molecular Formula | C19H16N6 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-ethyl-2-[(2-pyridin-2-ylimidazol-1-yl)methyl]benzimidazole-5-carbonitrile |
| SMILES | CCn1c(Cn2ccnc2-c2ccccn2)nc2cc(C#N)ccc21 |
| InChI | InChI=1S/C19H16N6/c1-2-25-17-7-6-14(12-20)11-16(17)23-18(25)13-24-10-9-22-19(24)15-5-3-4-8-21-15/h3-11H,2,13H2,1H3 |
| InChIKey | UFDGBPWAUJUWFJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |