C15H22BNO5 — CID 149146743
4,4,5,5-tetramethyl-2-(5-nitro-2-propan-2-yloxyphenyl)-1,3,2-dioxaborolane (PubChem CID 149146743) has the molecular formula C15H22BNO5 and a molecular weight of 307.16 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(5-nitro-2-propan-2-yloxyphenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(5-nitro-2-propan-2-yloxyphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 149146743 |
| Molecular Formula | C15H22BNO5 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(5-nitro-2-propan-2-yloxyphenyl)-1,3,2-dioxaborolane |
| SMILES | CC(C)Oc1ccc([N+](=O)[O-])cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H22BNO5/c1-10(2)20-13-8-7-11(17(18)19)9-12(13)16-21-14(3,4)15(5,6)22-16/h7-10H,1-6H3 |
| InChIKey | RKPWRGHPIZZGKB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|