C13H14I3N3O5 — CID 149149500
2-[[3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoyl]amino]-3-hydroxybutanoic acid (PubChem CID 149149500) has the molecular formula C13H14I3N3O5 and a molecular weight of 672.98 g/mol. Its IUPAC name is 2-[[3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 149149500 |
| Molecular Formula | C13H14I3N3O5 |
| Molecular Weight | 672.98 g/mol |
| Exact Mass | 672.81 |
| IUPAC Name | 2-[[3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CNC(=O)c1c(I)c(N)c(I)c(C(=O)NC(C(=O)O)C(C)O)c1I |
| InChI | InChI=1S/C13H14I3N3O5/c1-3(20)10(13(23)24)19-12(22)5-6(14)4(11(21)18-2)7(15)9(17)8(5)16/h3,10,20H,17H2,1-2H3,(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | UJIGHUOFVWXAKO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.98 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|