C33H37F2N5O5 — CID 149150527
1,4-bis[2-(4-fluorophenyl)ethyl]-N-(2-hydrazinyl-2-oxoethyl)-N-[2-(4-methoxyphenyl)ethyl]-3,7-dioxo-1,4-diazepane-5-carboxamide (PubChem CID 149150527) has the molecular formula C33H37F2N5O5 and a molecular weight of 621.69 g/mol. Its IUPAC name is 1,4-bis[2-(4-fluorophenyl)ethyl]-N-(2-hydrazinyl-2-oxoethyl)-N-[2-(4-methoxyphenyl)ethyl]-3,7-dioxo-1,4-diazepane-5-carboxamide.
| Compound Name | 1,4-bis[2-(4-fluorophenyl)ethyl]-N-(2-hydrazinyl-2-oxoethyl)-N-[2-(4-methoxyphenyl)ethyl]-3,7-dioxo-1,4-diazepane-5-carboxamide |
|---|---|
| PubChem CID | 149150527 |
| Molecular Formula | C33H37F2N5O5 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | 1,4-bis[2-(4-fluorophenyl)ethyl]-N-(2-hydrazinyl-2-oxoethyl)-N-[2-(4-methoxyphenyl)ethyl]-3,7-dioxo-1,4-diazepane-5-carboxamide |
| SMILES | COc1ccc(CCN(CC(=O)NN)C(=O)C2CC(=O)N(CCc3ccc(F)cc3)CC(=O)N2CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H37F2N5O5/c1-45-28-12-6-25(7-13-28)15-18-39(21-30(41)37-36)33(44)29-20-31(42)38(17-14-23-2-8-26(34)9-3-23)22-32(43)40(29)19-16-24-4-10-27(35)11-5-24/h2-13,29H,14-22,36H2,1H3,(H,37,41) |
| InChIKey | MEYYXTGHJXBKSF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|