C11H12N2O5 — CID 149152181
1-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]pyrrole-2,5-dione (PubChem CID 149152181) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 149152181 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)oxypropyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H12N2O5/c14-8-2-3-9(15)12(8)6-1-7-18-13-10(16)4-5-11(13)17/h2-3H,1,4-7H2 |
| InChIKey | JNQHWIRNLLFBPR-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|