C24H23Cl2N7O2S2 — CID 149154548
5-[(5S)-5-aminospiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-yl]-8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridine-7-sulfonamide (PubChem CID 149154548) has the molecular formula C24H23Cl2N7O2S2 and a molecular weight of 576.54 g/mol. Its IUPAC name is 5-[(5S)-5-aminospiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-yl]-8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridine-7-sulfonamide.
| Compound Name | 5-[(5S)-5-aminospiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-yl]-8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridine-7-sulfonamide |
|---|---|
| PubChem CID | 149154548 |
| Molecular Formula | C24H23Cl2N7O2S2 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 575.07 |
| IUPAC Name | 5-[(5S)-5-aminospiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-yl]-8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridine-7-sulfonamide |
| SMILES | N[C@@H]1c2cccnc2CC12CCN(c1cc(S(N)(=O)=O)c(Sc3cccc(Cl)c3Cl)c3nncn13)CC2 |
| InChI | InChI=1S/C24H23Cl2N7O2S2/c25-15-4-1-5-17(20(15)26)36-21-18(37(28,34)35)11-19(33-13-30-31-23(21)33)32-9-6-24(7-10-32)12-16-14(22(24)27)3-2-8-29-16/h1-5,8,11,13,22H,6-7,9-10,12,27H2,(H2,28,34,35)/t22-/m1/s1 |
| InChIKey | RNCRUSYDOFWCJH-JOCHJYFZSA-N |
| XLogP | 4.07 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |