C15H17FN2O5 — CID 149183020
ethyl 3-[4-fluoro-5-[(1S)-2-methylcyclopropyl]-2-nitroanilino]-3-oxopropanoate (PubChem CID 149183020) has the molecular formula C15H17FN2O5 and a molecular weight of 324.31 g/mol. Its IUPAC name is ethyl 3-[4-fluoro-5-[(1S)-2-methylcyclopropyl]-2-nitroanilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-fluoro-5-[(1S)-2-methylcyclopropyl]-2-nitroanilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 149183020 |
| Molecular Formula | C15H17FN2O5 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | ethyl 3-[4-fluoro-5-[(1S)-2-methylcyclopropyl]-2-nitroanilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1cc([C@H]2CC2C)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17FN2O5/c1-3-23-15(20)7-14(19)17-12-5-10(9-4-8(9)2)11(16)6-13(12)18(21)22/h5-6,8-9H,3-4,7H2,1-2H3,(H,17,19)/t8?,9-/m0/s1 |
| InChIKey | XBIDKCCKTOVXNR-GKAPJAKFSA-N |
| XLogP | 2.75 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|