C12H9NO2S — CID 14918529
5,5-dioxodibenzothiophen-2-amine (PubChem CID 14918529) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is 5,5-dioxodibenzothiophen-2-amine.
| Compound Name | 5,5-dioxodibenzothiophen-2-amine |
|---|---|
| PubChem CID | 14918529 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 5,5-dioxodibenzothiophen-2-amine |
| SMILES | Nc1ccc2c(c1)-c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C12H9NO2S/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)16(12,14)15/h1-7H,13H2 |
| InChIKey | JPWDVOFSOTVCEL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|