C20H22ClF2N3O — CID 149200619
(3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-[1-deuterio-3-(5-methylpyrimidin-2-yl)propyl]-4-fluoropiperidin-1-yl]methanone (PubChem CID 149200619) has the molecular formula C20H22ClF2N3O and a molecular weight of 402.92 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-[1-deuterio-3-(5-methylpyrimidin-2-yl)propyl]-4-fluoropiperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-[1-deuterio-3-(5-methylpyrimidin-2-yl)propyl]-4-fluoropiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 149200619 |
| Molecular Formula | C20H22ClF2N3O |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-[1-deuterio-3-(5-methylpyrimidin-2-yl)propyl]-4-fluoropiperidin-1-yl]methanone |
| SMILES | [2H]C(CCc1ncc(C)cn1)C1(F)C([2H])([2H])C([2H])([2H])N(C(=O)c2ccc(F)c(Cl)c2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C20H22ClF2N3O/c1-14-12-24-18(25-13-14)3-2-6-20(23)7-9-26(10-8-20)19(27)15-4-5-17(22)16(21)11-15/h4-5,11-13H,2-3,6-10H2,1H3/i6D,7D2,8D2,9D2,10D2 |
| InChIKey | XEPURSYQKJMACZ-UDABLIESSA-N |
| XLogP | 4.54 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |