C21H23ClF2N2O — CID 153129523
(3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-fluoro-4-[1,1,3,3-tetradeuterio-3-[5-(trideuteriomethyl)-2-pyridinyl]propyl]piperidin-1-yl]methanone (PubChem CID 153129523) has the molecular formula C21H23ClF2N2O and a molecular weight of 407.97 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-fluoro-4-[1,1,3,3-tetradeuterio-3-[5-(trideuteriomethyl)-2-pyridinyl]propyl]piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-fluoro-4-[1,1,3,3-tetradeuterio-3-[5-(trideuteriomethyl)-2-pyridinyl]propyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 153129523 |
| Molecular Formula | C21H23ClF2N2O |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5,6,6-octadeuterio-4-fluoro-4-[1,1,3,3-tetradeuterio-3-[5-(trideuteriomethyl)-2-pyridinyl]propyl]piperidin-1-yl]methanone |
| SMILES | [2H]C([2H])([2H])c1ccc(C([2H])([2H])CC([2H])([2H])C2(F)C([2H])([2H])C([2H])([2H])N(C(=O)c3ccc(F)c(Cl)c3)C([2H])([2H])C2([2H])[2H])nc1 |
| InChI | InChI=1S/C21H23ClF2N2O/c1-15-4-6-17(25-14-15)3-2-8-21(24)9-11-26(12-10-21)20(27)16-5-7-19(23)18(22)13-16/h4-7,13-14H,2-3,8-12H2,1H3/i1D3,3D2,8D2,9D2,10D2,11D2,12D2 |
| InChIKey | VWLMJYXYYMNGIF-YJCRETTBSA-N |
| XLogP | 5.15 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |