C22H25ClF2N2O — CID 158685026
(3-chloro-4-fluorophenyl)-[2,2,3,3,5,5-hexadeuterio-4-[3,3-dideuterio-3-[5-(1,1-dideuterioethyl)-2-pyridinyl]propyl]-4-fluoropiperidin-1-yl]methanone (PubChem CID 158685026) has the molecular formula C22H25ClF2N2O and a molecular weight of 416.97 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5-hexadeuterio-4-[3,3-dideuterio-3-[5-(1,1-dideuterioethyl)-2-pyridinyl]propyl]-4-fluoropiperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5-hexadeuterio-4-[3,3-dideuterio-3-[5-(1,1-dideuterioethyl)-2-pyridinyl]propyl]-4-fluoropiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 158685026 |
| Molecular Formula | C22H25ClF2N2O |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[2,2,3,3,5,5-hexadeuterio-4-[3,3-dideuterio-3-[5-(1,1-dideuterioethyl)-2-pyridinyl]propyl]-4-fluoropiperidin-1-yl]methanone |
| SMILES | [2H]C([2H])(C)c1ccc(C([2H])([2H])CCC2(F)C([2H])([2H])CN(C(=O)c3ccc(F)c(Cl)c3)C([2H])([2H])C2([2H])[2H])nc1 |
| InChI | InChI=1S/C22H25ClF2N2O/c1-2-16-5-7-18(26-15-16)4-3-9-22(25)10-12-27(13-11-22)21(28)17-6-8-20(24)19(23)14-17/h5-8,14-15H,2-4,9-13H2,1H3/i2D2,4D2,10D2,11D2,12D2 |
| InChIKey | BLGPBXIUTDDFJL-IWOXTSLTSA-N |
| XLogP | 5.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |