C23H19FN4O2S — CID 1492231
1-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4-(2-fluoroanilino)pyrrole-2,5-dione (PubChem CID 1492231) has the molecular formula C23H19FN4O2S and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4-(2-fluoroanilino)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4-(2-fluoroanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1492231 |
| Molecular Formula | C23H19FN4O2S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4-(2-fluoroanilino)pyrrole-2,5-dione |
| SMILES | Cc1cc(C)nc(SC2=C(Nc3ccccc3F)C(=O)N(Cc3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C23H19FN4O2S/c1-14-12-15(2)26-23(25-14)31-20-19(27-18-11-7-6-10-17(18)24)21(29)28(22(20)30)13-16-8-4-3-5-9-16/h3-12,27H,13H2,1-2H3 |
| InChIKey | LSARDUSYTDLNDS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|