C24H21ClN4O2S — CID 1194837
1-benzyl-3-(4-chloro-2-methylanilino)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrole-2,5-dione (PubChem CID 1194837) has the molecular formula C24H21ClN4O2S and a molecular weight of 464.98 g/mol. Its IUPAC name is 1-benzyl-3-(4-chloro-2-methylanilino)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(4-chloro-2-methylanilino)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 1194837 |
| Molecular Formula | C24H21ClN4O2S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-benzyl-3-(4-chloro-2-methylanilino)-4-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrole-2,5-dione |
| SMILES | Cc1cc(C)nc(SC2=C(Nc3ccc(Cl)cc3C)C(=O)N(Cc3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C24H21ClN4O2S/c1-14-11-18(25)9-10-19(14)28-20-21(32-24-26-15(2)12-16(3)27-24)23(31)29(22(20)30)13-17-7-5-4-6-8-17/h4-12,28H,13H2,1-3H3 |
| InChIKey | RPBLSZRNJUJGQE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|