C19H23ClNOPSi — CID 149228116
[(3R,3aR)-1-chloro-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-methyl-diphenylsilane (PubChem CID 149228116) has the molecular formula C19H23ClNOPSi and a molecular weight of 375.91 g/mol. Its IUPAC name is [(3R,3aR)-1-chloro-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-methyl-diphenylsilane.
| Compound Name | [(3R,3aR)-1-chloro-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-methyl-diphenylsilane |
|---|---|
| PubChem CID | 149228116 |
| Molecular Formula | C19H23ClNOPSi |
| Molecular Weight | 375.91 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [(3R,3aR)-1-chloro-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-methyl-diphenylsilane |
| SMILES | C[Si](C[C@@H]1OP(Cl)N2CCC[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23ClNOPSi/c1-24(16-9-4-2-5-10-16,17-11-6-3-7-12-17)15-19-18-13-8-14-21(18)23(20)22-19/h2-7,9-12,18-19H,8,13-15H2,1H3/t18-,19+,23?/m1/s1 |
| InChIKey | XJTPHMFBBBWPRZ-BEWYTNLXSA-N |
| XLogP | 4.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|