C12H15ClNO2P — CID 139505468
(3R)-1-chloro-3-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole (PubChem CID 139505468) has the molecular formula C12H15ClNO2P and a molecular weight of 271.68 g/mol. Its IUPAC name is (3R)-1-chloro-3-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole.
| Compound Name | (3R)-1-chloro-3-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole |
|---|---|
| PubChem CID | 139505468 |
| Molecular Formula | C12H15ClNO2P |
| Molecular Weight | 271.68 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (3R)-1-chloro-3-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole |
| SMILES | COc1ccc([C@H]2OP(Cl)N3CCCC23)cc1 |
| InChI | InChI=1S/C12H15ClNO2P/c1-15-10-6-4-9(5-7-10)12-11-3-2-8-14(11)17(13)16-12/h4-7,11-12H,2-3,8H2,1H3/t11?,12-,17?/m1/s1 |
| InChIKey | TUEQJKZVDKCGAW-VMBJYNEYSA-N |
| XLogP | 3.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|