C15H20N2O — CID 101087252
4-(4-methoxyphenyl)-4,4a,5,6,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine (PubChem CID 101087252) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-4,4a,5,6,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine.
| Compound Name | 4-(4-methoxyphenyl)-4,4a,5,6,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 101087252 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-4,4a,5,6,7,8-hexahydro-1H-pyrido[1,2-c]pyrimidine |
| SMILES | COc1ccc(C2C=NCN3CCCCC23)cc1 |
| InChI | InChI=1S/C15H20N2O/c1-18-13-7-5-12(6-8-13)14-10-16-11-17-9-3-2-4-15(14)17/h5-8,10,14-15H,2-4,9,11H2,1H3 |
| InChIKey | VXMHEAPAKUWHCF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |