C40H46N6O2 — CID 149231854
3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indol-5-ylmethylamino)propanamide (PubChem CID 149231854) has the molecular formula C40H46N6O2 and a molecular weight of 642.85 g/mol. Its IUPAC name is 3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indol-5-ylmethylamino)propanamide.
| Compound Name | 3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indol-5-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 149231854 |
| Molecular Formula | C40H46N6O2 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.37 |
| IUPAC Name | 3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indol-5-ylmethylamino)propanamide |
| SMILES | CCCN(CCC)c1ccc(-c2nc3cc(C(CC(N)=O)NCc4ccc5[nH]ccc5c4)ccc3n2CCc2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C40H46N6O2/c1-3-20-45(21-4-2)34-13-10-31(11-14-34)40-44-37-24-32(12-16-38(37)46(40)22-18-28-5-7-29(27-47)8-6-28)36(25-39(41)48)43-26-30-9-15-35-33(23-30)17-19-42-35/h5-17,19,23-24,36,42-43,47H,3-4,18,20-22,25-27H2,1-2H3,(H2,41,48) |
| InChIKey | XKLKSTGGQJKCQY-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|