C38H38N4O3 — CID 155524875
2-[5-[[2-butyl-4-methyl-6-(3-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]indol-1-yl]benzoic acid (PubChem CID 155524875) has the molecular formula C38H38N4O3 and a molecular weight of 598.75 g/mol. Its IUPAC name is 2-[5-[[2-butyl-4-methyl-6-(3-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]indol-1-yl]benzoic acid.
| Compound Name | 2-[5-[[2-butyl-4-methyl-6-(3-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]indol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 155524875 |
| Molecular Formula | C38H38N4O3 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 2-[5-[[2-butyl-4-methyl-6-(3-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]indol-1-yl]benzoic acid |
| SMILES | CCCCc1nc2c(C)cc(C(=O)NCCCc3ccccc3)cc2n1Cc1ccc2c(ccn2-c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C38H38N4O3/c1-3-4-16-35-40-36-26(2)22-30(37(43)39-20-10-13-27-11-6-5-7-12-27)24-34(36)42(35)25-28-17-18-32-29(23-28)19-21-41(32)33-15-9-8-14-31(33)38(44)45/h5-9,11-12,14-15,17-19,21-24H,3-4,10,13,16,20,25H2,1-2H3,(H,39,43)(H,44,45) |
| InChIKey | KMDIXQWWOSFKHR-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|