C22H23NO6 — CID 149232219
2-ethynoxy-3-[4-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethoxy]phenyl]propanoic acid (PubChem CID 149232219) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-ethynoxy-3-[4-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethynoxy-3-[4-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 149232219 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-ethynoxy-3-[4-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethoxy]phenyl]propanoic acid |
| SMILES | C#COC(Cc1ccc(OCC(=O)NCCc2ccc(OC)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H23NO6/c1-3-28-20(22(25)26)14-17-6-10-19(11-7-17)29-15-21(24)23-13-12-16-4-8-18(27-2)9-5-16/h1,4-11,20H,12-15H2,2H3,(H,23,24)(H,25,26) |
| InChIKey | XKNCDPPVCGNWFU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|